The title complex chloro(p-toluidine)[4-(p-tolyl)imino-2-pentanone-3-oximato]- palladium(Ⅱ), PdCl(p-CH3C6H4NH2)(p-CH3C6H4-iai), C19H22ClN3O2Pd, (p-CH3C6H4NH2 and p-CH3C6H4-iai- are p-toluidine and the anion of 4-(p-tolyl)imino-2-pentanone-3-oximato, respec- tively), crystallizes in the monoclinic system, space group C2/c with a = 26.082(5), b = 13.521(3), c = 12.578(3) ? b = 112.18(3), Mr = 466.25, V = 4108(2) 3, Dc = 1.508 g/cm3, F(000) = 1888, m(MoKa) = 1.051 mm-1, Z = 8, the final R = 0.0368 and wR = 0.0855 for 3243 observed reflections (I ≥ 2s(I)). The coordination environment around Pd is a distorted PdClN3 square-plane composed of imino- and oximo-nitrogen from the Schiff base ligand of p-CH3C6H4-iai-, and amino-nitrogen from p-toluidine and chlorine atom.
Two title compounds, 4,4?diformyl-diphenoxyethane (compound 1, C16H14O4) and 4,4?4创-triformyl-triphenoxytriethylamine (compound 2, C27H27NO6), were synthesized by condensation of 4-hydroxybenzaldehyde with 1,2-dichloroethane and tris(2-chloroethyl)amine, respectively in dimethyl formamide in the presence of anhydrous potassium carbonate. The crystal data are: monoclinic, P21/c, a = 7.571(2), b = 12.608(3), c = 7.357(2) ? b = 105.823(6)? V = 675.7(2) 3, Mr = 270.3, Z = 2, Dc = 1.328 g/cm3, F(000) = 284, m(MoKa) = 0.096 mm-1, R = 0.0537 and wR = 0.2189 for compound 1; and monoclinic, P21/n, a = 11.7162(6), b = 9.0042(6), c = 22.908(2) ? b = 99.505(1)? V = 2383.5(3) ?, Mr = 461.50, Z = 4, Dc = 1.286 g/cm3, F(000)= 976, m(MoKa) = 0.091 mm-1, R = 0.0464 and wR = 0.1462 for compound 2. The molecule of compound 1 (dialdehyde) is located at the crystallographic inversion center nearby the midpoint of C(8)C(8A) single bond. The three chains in the molecule of compound 2 (trialdehyde) are of non-crystallographic pseudo-C3 symmetry, and each of them is quite planar.
